C23H34O8 — CID 71579128
[(1R,2R,4R,6S,8S,9S,10S,11S,13S,14R)-2,6,8-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate (PubChem CID 71579128) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(1R,2R,4R,6S,8S,9S,10S,11S,13S,14R)-2,6,8-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate.
| Compound Name | [(1R,2R,4R,6S,8S,9S,10S,11S,13S,14R)-2,6,8-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
|---|---|
| PubChem CID | 71579128 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | [(1R,2R,4R,6S,8S,9S,10S,11S,13S,14R)-2,6,8-trihydroxy-14-(methoxymethyl)-5,5,9-trimethyl-3,15-dioxo-11-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] acetate |
| SMILES | COC[C@@H]1C(=O)[C@]23C[C@H]1C[C@H](OC(C)=O)[C@H]2[C@@]1(C)[C@H](C(=O)[C@@H]3O)C(C)(C)[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H34O8/c1-10(24)31-13-6-11-8-23(19(28)12(11)9-30-5)17(13)22(4)15(26)7-14(25)21(2,3)18(22)16(27)20(23)29/h11-15,17-18,20,25-26,29H,6-9H2,1-5H3/t11-,12+,13+,14+,15+,17+,18-,20+,22+,23+/m1/s1 |
| InChIKey | MDENNICXVBURAU-AZABVYRPSA-N |
| XLogP | 0.49 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |