C20H28N6O3 — CID 71579157
2-[[[2-[[(2S)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]-6-methoxyphenol (PubChem CID 71579157) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]-6-methoxyphenol.
| Compound Name | 2-[[[2-[[(2S)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 71579157 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-[[[2-[[(2S)-1-hydroxybutan-2-yl]amino]-9-propan-2-ylpurin-6-yl]amino]methyl]-6-methoxyphenol |
| SMILES | CC[C@@H](CO)Nc1nc(NCc2cccc(OC)c2O)c2ncn(C(C)C)c2n1 |
| InChI | InChI=1S/C20H28N6O3/c1-5-14(10-27)23-20-24-18(16-19(25-20)26(11-22-16)12(2)3)21-9-13-7-6-8-15(29-4)17(13)28/h6-8,11-12,14,27-28H,5,9-10H2,1-4H3,(H2,21,23,24,25)/t14-/m0/s1 |
| InChIKey | RZRAYJQSPLLFCR-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|