C26H28ClN3O — CID 71579199
(1'R,4'S)-3-[3-(2-chlorophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] (PubChem CID 71579199) has the molecular formula C26H28ClN3O and a molecular weight of 433.98 g/mol. Its IUPAC name is (1'R,4'S)-3-[3-(2-chlorophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,4'S)-3-[3-(2-chlorophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 71579199 |
| Molecular Formula | C26H28ClN3O |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (1'R,4'S)-3-[3-(2-chlorophenyl)-2-phenyl-3,4-dihydropyrazol-5-yl]-2',2'-dimethylspiro[4H-1,2-oxazole-5,3'-bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)[C@@H]2CC[C@@H](C2)C12CC(C1=NN(c3ccccc3)C(c3ccccc3Cl)C1)=NO2 |
| InChI | InChI=1S/C26H28ClN3O/c1-25(2)17-12-13-18(14-17)26(25)16-23(29-31-26)22-15-24(20-10-6-7-11-21(20)27)30(28-22)19-8-4-3-5-9-19/h3-11,17-18,24H,12-16H2,1-2H3/t17-,18+,24?,26?/m1/s1 |
| InChIKey | XMILGJBPGUGOJB-VFICGRSJSA-N |
| XLogP | 6.62 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |