C25H34O5 — CID 71579367
(2S,4'aR,6S,8'aR)-2-[(E)-2,6-dimethyl-5-oxohept-1-enyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one (PubChem CID 71579367) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is (2S,4'aR,6S,8'aR)-2-[(E)-2,6-dimethyl-5-oxohept-1-enyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one.
| Compound Name | (2S,4'aR,6S,8'aR)-2-[(E)-2,6-dimethyl-5-oxohept-1-enyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one |
|---|---|
| PubChem CID | 71579367 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2S,4'aR,6S,8'aR)-2-[(E)-2,6-dimethyl-5-oxohept-1-enyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-5,8a-dihydro-4aH-chromene]-6'-one |
| SMILES | CC1=C[C@]2(C=C(CO)[C@H]3CC(=O)C(C)=C[C@H]3O2)O[C@H](/C=C(\C)CCC(=O)C(C)C)C1 |
| InChI | InChI=1S/C25H34O5/c1-15(2)22(27)7-6-16(3)8-20-9-17(4)12-25(29-20)13-19(14-26)21-11-23(28)18(5)10-24(21)30-25/h8,10,12-13,15,20-21,24,26H,6-7,9,11,14H2,1-5H3/b16-8+/t20-,21-,24-,25+/m1/s1 |
| InChIKey | ADVQUGFWSPNWGG-MMHRJDEDSA-N |
| XLogP | 4.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|