C27H38O7 — CID 71579369
[(2S,4'aR,6S,6'S,8'aR)-2-[(1E,4E)-6-hydroperoxy-2,6-dimethylhepta-1,4-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-4a,5,6,8a-tetrahydrochromene]-6'-yl] acetate (PubChem CID 71579369) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is [(2S,4'aR,6S,6'S,8'aR)-2-[(1E,4E)-6-hydroperoxy-2,6-dimethylhepta-1,4-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-4a,5,6,8a-tetrahydrochromene]-6'-yl] acetate.
| Compound Name | [(2S,4'aR,6S,6'S,8'aR)-2-[(1E,4E)-6-hydroperoxy-2,6-dimethylhepta-1,4-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-4a,5,6,8a-tetrahydrochromene]-6'-yl] acetate |
|---|---|
| PubChem CID | 71579369 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | [(2S,4'aR,6S,6'S,8'aR)-2-[(1E,4E)-6-hydroperoxy-2,6-dimethylhepta-1,4-dienyl]-4'-(hydroxymethyl)-4,7'-dimethylspiro[2,3-dihydropyran-6,2'-4a,5,6,8a-tetrahydrochromene]-6'-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2C(CO)=C[C@]3(C=C(C)C[C@@H](/C=C(\C)C/C=C/C(C)(C)OO)O3)O[C@@H]2C=C1C |
| InChI | InChI=1S/C27H38O7/c1-17(8-7-9-26(5,6)34-30)10-22-11-18(2)14-27(32-22)15-21(16-28)23-13-24(31-20(4)29)19(3)12-25(23)33-27/h7,9-10,12,14-15,22-25,28,30H,8,11,13,16H2,1-6H3/b9-7+,17-10+/t22-,23-,24+,25-,27+/m1/s1 |
| InChIKey | YGBUJACBKXHYOB-ZPNHJFRXSA-N |
| XLogP | 4.79 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|