About N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide
N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide (PubChem CID 71579592) has the molecular formula C22H23FN2O2S
and a molecular weight of 398.50 g/mol. Its IUPAC name is N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide |
| PubChem CID | 71579592 |
| Molecular Formula | C22H23FN2O2S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide |
| SMILES | CCN(CC)C(=O)C1Sc2cc(O)ccc2-c2c1c1ccccc1n2CCF |
| InChI | InChI=1S/C22H23FN2O2S/c1-3-24(4-2)22(27)21-19-15-7-5-6-8-17(15)25(12-11-23)20(19)16-10-9-14(26)13-18(16)28-21/h5-10,13,21,26H,3-4,11-12H2,1-2H3 |
| InChIKey | SDGKIWUBFJUGKZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The IUPAC name of N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide (CID 71579592) is N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide.
What is the SMILES notation for N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The canonical SMILES for N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide is CCN(CC)C(=O)C1Sc2cc(O)ccc2-c2c1c1ccccc1n2CCF.
What is the InChIKey of N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
The InChIKey is SDGKIWUBFJUGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23FN2O2S/c1-3-24(4-2)22(27)21-19-15-7-5-6-8-17(15)25(12-11-23)20(19)16-10-9-14(26)13-18(16)28-21/h5-10,13,21,26H,3-4,11-12H2,1-2H3.
What are the key properties of N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide?
N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide has a molecular weight of 398.50 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-11-(2-fluoroethyl)-3-hydroxy-6H-thiochromeno[4,3-b]indole-6-carboxamide is sourced from PubChem (CID 71579592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).