C21H28O10 — CID 71579641
3-methyl-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-3-phenylprop-2-enoxy]oxan-2-yl]methoxy]pentanedioic acid (PubChem CID 71579641) has the molecular formula C21H28O10 and a molecular weight of 440.45 g/mol. Its IUPAC name is 3-methyl-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-3-phenylprop-2-enoxy]oxan-2-yl]methoxy]pentanedioic acid.
| Compound Name | 3-methyl-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-3-phenylprop-2-enoxy]oxan-2-yl]methoxy]pentanedioic acid |
|---|---|
| PubChem CID | 71579641 |
| Molecular Formula | C21H28O10 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-methyl-3-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-3-phenylprop-2-enoxy]oxan-2-yl]methoxy]pentanedioic acid |
| SMILES | CC(CC(=O)O)(CC(=O)O)OC[C@H]1O[C@@H](OC/C=C/c2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H28O10/c1-21(10-15(22)23,11-16(24)25)30-12-14-17(26)18(27)19(28)20(31-14)29-9-5-8-13-6-3-2-4-7-13/h2-8,14,17-20,26-28H,9-12H2,1H3,(H,22,23)(H,24,25)/b8-5+/t14-,17-,18+,19-,20-/m1/s1 |
| InChIKey | XCAAQXCIKODIDY-QUNBHGSGSA-N |
| XLogP | 0.25 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |