C19H35NO2 — CID 71579652
N-cyclooctyl-2,2-dimethyl-N-(6-oxohexyl)propanamide (PubChem CID 71579652) has the molecular formula C19H35NO2 and a molecular weight of 309.49 g/mol. Its IUPAC name is N-cyclooctyl-2,2-dimethyl-N-(6-oxohexyl)propanamide.
| Compound Name | N-cyclooctyl-2,2-dimethyl-N-(6-oxohexyl)propanamide |
|---|---|
| PubChem CID | 71579652 |
| Molecular Formula | C19H35NO2 |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.27 |
| IUPAC Name | N-cyclooctyl-2,2-dimethyl-N-(6-oxohexyl)propanamide |
| SMILES | CC(C)(C)C(=O)N(CCCCCC=O)C1CCCCCCC1 |
| InChI | InChI=1S/C19H35NO2/c1-19(2,3)18(22)20(15-11-7-8-12-16-21)17-13-9-5-4-6-10-14-17/h16-17H,4-15H2,1-3H3 |
| InChIKey | GYSRSNILGMVZKC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|