About 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide
5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide (PubChem CID 71579695) has the molecular formula C20H15Cl2FN2O3
and a molecular weight of 421.26 g/mol. Its IUPAC name is 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide |
| PubChem CID | 71579695 |
| Molecular Formula | C20H15Cl2FN2O3 |
| Molecular Weight | 421.26 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H](Oc1c[nH]c(=O)c(C(=O)Nc2ccccc2)c1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H15Cl2FN2O3/c1-11(17-15(21)7-8-16(23)18(17)22)28-13-9-14(19(26)24-10-13)20(27)25-12-5-3-2-4-6-12/h2-11H,1H3,(H,24,26)(H,25,27)/t11-/m1/s1 |
| InChIKey | OUEBJJYTKIGEHU-LLVKDONJSA-N |
| XLogP | 5.21 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide?
The IUPAC name of 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide (CID 71579695) is 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide.
What is the SMILES notation for 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide?
The canonical SMILES for 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide is C[C@@H](Oc1c[nH]c(=O)c(C(=O)Nc2ccccc2)c1)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide?
The InChIKey is OUEBJJYTKIGEHU-LLVKDONJSA-N. The full InChI is InChI=1S/C20H15Cl2FN2O3/c1-11(17-15(21)7-8-16(23)18(17)22)28-13-9-14(19(26)24-10-13)20(27)25-12-5-3-2-4-6-12/h2-11H,1H3,(H,24,26)(H,25,27)/t11-/m1/s1.
What are the key properties of 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide?
5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide has a molecular weight of 421.26 g/mol, XLogP of 5.21, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-phenyl-1H-pyridine-3-carboxamide is sourced from PubChem (CID 71579695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).