C19H13ClF2N2O4 — CID 71579721
methyl 6-chloro-7-(3,4-difluoroanilino)-1,3-dimethyl-5,8-dioxoisoquinoline-4-carboxylate (PubChem CID 71579721) has the molecular formula C19H13ClF2N2O4 and a molecular weight of 406.77 g/mol. Its IUPAC name is methyl 6-chloro-7-(3,4-difluoroanilino)-1,3-dimethyl-5,8-dioxoisoquinoline-4-carboxylate.
| Compound Name | methyl 6-chloro-7-(3,4-difluoroanilino)-1,3-dimethyl-5,8-dioxoisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 71579721 |
| Molecular Formula | C19H13ClF2N2O4 |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | methyl 6-chloro-7-(3,4-difluoroanilino)-1,3-dimethyl-5,8-dioxoisoquinoline-4-carboxylate |
| SMILES | COC(=O)c1c(C)nc(C)c2c1C(=O)C(Cl)=C(Nc1ccc(F)c(F)c1)C2=O |
| InChI | InChI=1S/C19H13ClF2N2O4/c1-7-12-14(13(8(2)23-7)19(27)28-3)17(25)15(20)16(18(12)26)24-9-4-5-10(21)11(22)6-9/h4-6,24H,1-3H3 |
| InChIKey | UEFXJDVNCCYKIK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|