C24H19N3O2S — CID 71579728
5-amino-2,7-bis(4-methoxyphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile (PubChem CID 71579728) has the molecular formula C24H19N3O2S and a molecular weight of 413.50 g/mol. Its IUPAC name is 5-amino-2,7-bis(4-methoxyphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile.
| Compound Name | 5-amino-2,7-bis(4-methoxyphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 71579728 |
| Molecular Formula | C24H19N3O2S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 5-amino-2,7-bis(4-methoxyphenyl)-2,3-dihydro-1-benzothiophene-4,6-dicarbonitrile |
| SMILES | COc1ccc(-c2c(C#N)c(N)c(C#N)c3c2SC(c2ccc(OC)cc2)C3)cc1 |
| InChI | InChI=1S/C24H19N3O2S/c1-28-16-7-3-14(4-8-16)21-11-18-19(12-25)23(27)20(13-26)22(24(18)30-21)15-5-9-17(29-2)10-6-15/h3-10,21H,11,27H2,1-2H3 |
| InChIKey | CQVXUKZWEVMJFC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|