About methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate
methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate (PubChem CID 71579762) has the molecular formula C9H9BrO4
and a molecular weight of 261.07 g/mol. Its IUPAC name is methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate |
| PubChem CID | 71579762 |
| Molecular Formula | C9H9BrO4 |
| Molecular Weight | 261.07 g/mol |
| Exact Mass | 259.97 |
| IUPAC Name | methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate |
| SMILES | COC(=O)Cc1cc(O)c(O)cc1Br |
| InChI | InChI=1S/C9H9BrO4/c1-14-9(13)3-5-2-7(11)8(12)4-6(5)10/h2,4,11-12H,3H2,1H3 |
| InChIKey | OHSQNDQTFXPYER-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate?
The IUPAC name of methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate (CID 71579762) is methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate.
What is the SMILES notation for methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate?
The canonical SMILES for methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate is COC(=O)Cc1cc(O)c(O)cc1Br.
What is the InChIKey of methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate?
The InChIKey is OHSQNDQTFXPYER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO4/c1-14-9(13)3-5-2-7(11)8(12)4-6(5)10/h2,4,11-12H,3H2,1H3.
What are the key properties of methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate?
methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate has a molecular weight of 261.07 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-bromo-4,5-dihydroxyphenyl)acetate is sourced from PubChem (CID 71579762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).