About 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide
4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide (PubChem CID 71579773) has the molecular formula C20H17N3O2S
and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide |
| PubChem CID | 71579773 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(-c3ccc(C#N)cc3)cc2)nc1C |
| InChI | InChI=1S/C20H17N3O2S/c1-14-3-12-20(22-15(14)2)23-26(24,25)19-10-8-18(9-11-19)17-6-4-16(13-21)5-7-17/h3-12H,1-2H3,(H,22,23) |
| InChIKey | PUZJTIRBRVVVSX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide?
The IUPAC name of 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide (CID 71579773) is 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide.
What is the SMILES notation for 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide?
The canonical SMILES for 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide is Cc1ccc(NS(=O)(=O)c2ccc(-c3ccc(C#N)cc3)cc2)nc1C.
What is the InChIKey of 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide?
The InChIKey is PUZJTIRBRVVVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2S/c1-14-3-12-20(22-15(14)2)23-26(24,25)19-10-8-18(9-11-19)17-6-4-16(13-21)5-7-17/h3-12H,1-2H3,(H,22,23).
What are the key properties of 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide?
4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide has a molecular weight of 363.44 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-cyanophenyl)-N-(5,6-dimethyl-2-pyridinyl)benzenesulfonamide is sourced from PubChem (CID 71579773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).