C26H26Cl2FN3O3 — CID 71579789
5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-[3-(piperidin-1-ylmethyl)phenyl]-1H-pyridine-3-carboxamide (PubChem CID 71579789) has the molecular formula C26H26Cl2FN3O3 and a molecular weight of 518.42 g/mol. Its IUPAC name is 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-[3-(piperidin-1-ylmethyl)phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-[3-(piperidin-1-ylmethyl)phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 71579789 |
| Molecular Formula | C26H26Cl2FN3O3 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.13 |
| IUPAC Name | 5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-oxo-N-[3-(piperidin-1-ylmethyl)phenyl]-1H-pyridine-3-carboxamide |
| SMILES | C[C@@H](Oc1c[nH]c(=O)c(C(=O)Nc2cccc(CN3CCCCC3)c2)c1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C26H26Cl2FN3O3/c1-16(23-21(27)8-9-22(29)24(23)28)35-19-13-20(25(33)30-14-19)26(34)31-18-7-5-6-17(12-18)15-32-10-3-2-4-11-32/h5-9,12-14,16H,2-4,10-11,15H2,1H3,(H,30,33)(H,31,34)/t16-/m1/s1 |
| InChIKey | BCORTDXDARSESF-MRXNPFEDSA-N |
| XLogP | 6.20 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|