C32H37N3O — CID 71579829
(1S,9S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(5-phenyl-2-pyridinyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide (PubChem CID 71579829) has the molecular formula C32H37N3O and a molecular weight of 479.67 g/mol. Its IUPAC name is (1S,9S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(5-phenyl-2-pyridinyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide.
| Compound Name | (1S,9S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(5-phenyl-2-pyridinyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
|---|---|
| PubChem CID | 71579829 |
| Molecular Formula | C32H37N3O |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (1S,9S,13R)-10-(cyclopropylmethyl)-1,13-dimethyl-N-[2-(5-phenyl-2-pyridinyl)ethyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxamide |
| SMILES | C[C@H]1[C@@H]2Cc3ccc(C(=O)NCCc4ccc(-c5ccccc5)cn4)cc3[C@@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C32H37N3O/c1-22-30-19-25-10-11-26(18-29(25)32(22,2)15-17-35(30)21-23-8-9-23)31(36)33-16-14-28-13-12-27(20-34-28)24-6-4-3-5-7-24/h3-7,10-13,18,20,22-23,30H,8-9,14-17,19,21H2,1-2H3,(H,33,36)/t22-,30-,32-/m0/s1 |
| InChIKey | MJYXXZICLYPENA-CLBLHBHFSA-N |
| XLogP | 5.66 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |