C42H68O8Si2 — CID 71579944
bis(2-butoxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate (PubChem CID 71579944) has the molecular formula C42H68O8Si2 and a molecular weight of 757.17 g/mol. Its IUPAC name is bis(2-butoxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate.
| Compound Name | bis(2-butoxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 71579944 |
| Molecular Formula | C42H68O8Si2 |
| Molecular Weight | 757.17 g/mol |
| Exact Mass | 756.45 |
| IUPAC Name | bis(2-butoxyethyl) 2,4-bis[4-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclobutane-1,3-dicarboxylate |
| SMILES | CCCCOCCOC(=O)C1C(c2ccc(O[Si](C)(C)C(C)(C)C)cc2)C(C(=O)OCCOCCCC)C1c1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C42H68O8Si2/c1-13-15-25-45-27-29-47-39(43)37-35(31-17-21-33(22-18-31)49-51(9,10)41(3,4)5)38(40(44)48-30-28-46-26-16-14-2)36(37)32-19-23-34(24-20-32)50-52(11,12)42(6,7)8/h17-24,35-38H,13-16,25-30H2,1-12H3 |
| InChIKey | GREXSQRAWSQNIP-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.17 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|