C19H19Cl2FN4O3 — CID 71580216
4-[(1R)-1-cyclopropyl-2-(2-fluoroethoxy)ethyl]-6-(2,6-dichloro-4-methoxyanilino)-5-oxopyrazine-2-carbonitrile (PubChem CID 71580216) has the molecular formula C19H19Cl2FN4O3 and a molecular weight of 441.29 g/mol. Its IUPAC name is 4-[(1R)-1-cyclopropyl-2-(2-fluoroethoxy)ethyl]-6-(2,6-dichloro-4-methoxyanilino)-5-oxopyrazine-2-carbonitrile.
| Compound Name | 4-[(1R)-1-cyclopropyl-2-(2-fluoroethoxy)ethyl]-6-(2,6-dichloro-4-methoxyanilino)-5-oxopyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 71580216 |
| Molecular Formula | C19H19Cl2FN4O3 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 4-[(1R)-1-cyclopropyl-2-(2-fluoroethoxy)ethyl]-6-(2,6-dichloro-4-methoxyanilino)-5-oxopyrazine-2-carbonitrile |
| SMILES | COc1cc(Cl)c(Nc2nc(C#N)cn([C@@H](COCCF)C3CC3)c2=O)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2FN4O3/c1-28-13-6-14(20)17(15(21)7-13)25-18-19(27)26(9-12(8-23)24-18)16(11-2-3-11)10-29-5-4-22/h6-7,9,11,16H,2-5,10H2,1H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | QCWHIGGQCRDNIC-INIZCTEOSA-N |
| XLogP | 4.11 |
| TPSA | 89.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|