About bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate
bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate (PubChem CID 71580350) has the molecular formula C24H28O6S2
and a molecular weight of 476.62 g/mol. Its IUPAC name is bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate |
| PubChem CID | 71580350 |
| Molecular Formula | C24H28O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate |
| SMILES | CSCCOC(=O)C1C(c2ccc(O)cc2)C(C(=O)OCCSC)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C24H28O6S2/c1-31-13-11-29-23(27)21-19(15-3-7-17(25)8-4-15)22(24(28)30-12-14-32-2)20(21)16-5-9-18(26)10-6-16/h3-10,19-22,25-26H,11-14H2,1-2H3 |
| InChIKey | PWTOWLSLHHODKW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate?
The IUPAC name of bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate (CID 71580350) is bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate.
What is the SMILES notation for bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate?
The canonical SMILES for bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate is CSCCOC(=O)C1C(c2ccc(O)cc2)C(C(=O)OCCSC)C1c1ccc(O)cc1.
What is the InChIKey of bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate?
The InChIKey is PWTOWLSLHHODKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O6S2/c1-31-13-11-29-23(27)21-19(15-3-7-17(25)8-4-15)22(24(28)30-12-14-32-2)20(21)16-5-9-18(26)10-6-16/h3-10,19-22,25-26H,11-14H2,1-2H3.
What are the key properties of bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate?
bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate has a molecular weight of 476.62 g/mol, XLogP of 4.02, 10 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylsulfanylethyl) 2,4-bis(4-hydroxyphenyl)cyclobutane-1,3-dicarboxylate is sourced from PubChem (CID 71580350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).