About 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile
4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile (PubChem CID 71580391) has the molecular formula C15H8ClF2N3
and a molecular weight of 303.70 g/mol. Its IUPAC name is 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile |
| PubChem CID | 71580391 |
| Molecular Formula | C15H8ClF2N3 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(Cl)c(NCc2ccccc2)c(C#N)c1F |
| InChI | InChI=1S/C15H8ClF2N3/c16-12-14(18)10(6-19)13(17)11(7-20)15(12)21-8-9-4-2-1-3-5-9/h1-5,21H,8H2 |
| InChIKey | FJLRLRNXJLDEIR-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile?
The IUPAC name of 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile (CID 71580391) is 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile.
What is the SMILES notation for 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile?
The canonical SMILES for 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile is N#Cc1c(F)c(Cl)c(NCc2ccccc2)c(C#N)c1F.
What is the InChIKey of 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile?
The InChIKey is FJLRLRNXJLDEIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8ClF2N3/c16-12-14(18)10(6-19)13(17)11(7-20)15(12)21-8-9-4-2-1-3-5-9/h1-5,21H,8H2.
What are the key properties of 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile?
4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile has a molecular weight of 303.70 g/mol, XLogP of 3.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(benzylamino)-5-chloro-2,6-difluorobenzene-1,3-dicarbonitrile is sourced from PubChem (CID 71580391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).