C27H48N2O5 — CID 71580559
N-(1-adamantyl)-2,2-dimethyl-N-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]propanamide (PubChem CID 71580559) has the molecular formula C27H48N2O5 and a molecular weight of 480.69 g/mol. Its IUPAC name is N-(1-adamantyl)-2,2-dimethyl-N-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]propanamide.
| Compound Name | N-(1-adamantyl)-2,2-dimethyl-N-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]propanamide |
|---|---|
| PubChem CID | 71580559 |
| Molecular Formula | C27H48N2O5 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | N-(1-adamantyl)-2,2-dimethyl-N-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]propanamide |
| SMILES | CC(C)(C)C(=O)N(CCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H48N2O5/c1-26(2,3)25(34)29(27-13-18-10-19(14-27)12-20(11-18)15-27)9-7-5-4-6-8-28-16-22(31)24(33)23(32)21(28)17-30/h18-24,30-33H,4-17H2,1-3H3/t18?,19?,20?,21-,22+,23-,24-,27?/m1/s1 |
| InChIKey | CGBRFGIKFKBSBQ-DSRLFJKWSA-N |
| XLogP | 2.15 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|