C22H29BrO3 — CID 71580666
4-[[(1R,4aR,6S,8aR)-6-bromo-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxybenzaldehyde (PubChem CID 71580666) has the molecular formula C22H29BrO3 and a molecular weight of 421.38 g/mol. Its IUPAC name is 4-[[(1R,4aR,6S,8aR)-6-bromo-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxybenzaldehyde.
| Compound Name | 4-[[(1R,4aR,6S,8aR)-6-bromo-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxybenzaldehyde |
|---|---|
| PubChem CID | 71580666 |
| Molecular Formula | C22H29BrO3 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 4-[[(1R,4aR,6S,8aR)-6-bromo-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methyl]-2,5-dihydroxybenzaldehyde |
| SMILES | CC1=CC[C@H]2C(C)(C)[C@@H](Br)CC[C@]2(C)[C@@H]1Cc1cc(O)c(C=O)cc1O |
| InChI | InChI=1S/C22H29BrO3/c1-13-5-6-19-21(2,3)20(23)7-8-22(19,4)16(13)9-14-10-18(26)15(12-24)11-17(14)25/h5,10-12,16,19-20,25-26H,6-9H2,1-4H3/t16-,19+,20+,22-/m1/s1 |
| InChIKey | YWIUEGBOJQCYTG-MOFCZTIZSA-N |
| XLogP | 5.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|