About 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine
4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine (PubChem CID 71580743) has the molecular formula C11H9N5
and a molecular weight of 211.23 g/mol. Its IUPAC name is 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine |
| PubChem CID | 71580743 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine |
| SMILES | Nc1nccc(-n2ccc3ccncc32)n1 |
| InChI | InChI=1S/C11H9N5/c12-11-14-5-2-10(15-11)16-6-3-8-1-4-13-7-9(8)16/h1-7H,(H2,12,14,15) |
| InChIKey | LAAXCJUGGGGBEQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine?
The IUPAC name of 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine (CID 71580743) is 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine.
What is the SMILES notation for 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine?
The canonical SMILES for 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine is Nc1nccc(-n2ccc3ccncc32)n1.
What is the InChIKey of 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine?
The InChIKey is LAAXCJUGGGGBEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5/c12-11-14-5-2-10(15-11)16-6-3-8-1-4-13-7-9(8)16/h1-7H,(H2,12,14,15).
What are the key properties of 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine?
4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine has a molecular weight of 211.23 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolo[2,3-c]pyridin-1-ylpyrimidin-2-amine is sourced from PubChem (CID 71580743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).