C22H23N2O3- — CID 7158126
5-[(3S)-3-(4-ethylphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate (PubChem CID 7158126) has the molecular formula C22H23N2O3- and a molecular weight of 363.44 g/mol. Its IUPAC name is 5-[(3S)-3-(4-ethylphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate.
| Compound Name | 5-[(3S)-3-(4-ethylphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate |
|---|---|
| PubChem CID | 7158126 |
| Molecular Formula | C22H23N2O3- |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 5-[(3S)-3-(4-ethylphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-5-oxopentanoate |
| SMILES | CCc1ccc([C@@H]2CC(c3ccccc3)=NN2C(=O)CCCC(=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-2-16-11-13-18(14-12-16)20-15-19(17-7-4-3-5-8-17)23-24(20)21(25)9-6-10-22(26)27/h3-5,7-8,11-14,20H,2,6,9-10,15H2,1H3,(H,26,27)/p-1/t20-/m0/s1 |
| InChIKey | ZLKLJIPSAHOWBA-FQEVSTJZSA-M |
| XLogP | 2.85 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |