About 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene
1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene (PubChem CID 71581394) has the molecular formula C24H22
and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene |
| PubChem CID | 71581394 |
| Molecular Formula | C24H22 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene |
| SMILES | Cc1ccc([C@@H]2CC(c3ccccc3)=C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22/c1-18-12-14-21(15-13-18)24-17-22(19-8-4-2-5-9-19)16-23(24)20-10-6-3-7-11-20/h2-16,23-24H,17H2,1H3/t23-,24-/m0/s1 |
| InChIKey | KOBNJHWDCVVDPQ-ZEQRLZLVSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene?
The IUPAC name of 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene (CID 71581394) is 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene.
What is the SMILES notation for 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene?
The canonical SMILES for 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene is Cc1ccc([C@@H]2CC(c3ccccc3)=C[C@H]2c2ccccc2)cc1.
What is the InChIKey of 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene?
The InChIKey is KOBNJHWDCVVDPQ-ZEQRLZLVSA-N. The full InChI is InChI=1S/C24H22/c1-18-12-14-21(15-13-18)24-17-22(19-8-4-2-5-9-19)16-23(24)20-10-6-3-7-11-20/h2-16,23-24H,17H2,1H3/t23-,24-/m0/s1.
What are the key properties of 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene?
1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene has a molecular weight of 310.44 g/mol, XLogP of 6.35, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,2R)-2,4-diphenylcyclopent-3-en-1-yl]-4-methylbenzene is sourced from PubChem (CID 71581394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).