C30H27F6N3O4 — CID 71581582
(2S)-N-(6-methoxy-3-pyridinyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 71581582) has the molecular formula C30H27F6N3O4 and a molecular weight of 607.55 g/mol. Its IUPAC name is (2S)-N-(6-methoxy-3-pyridinyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-N-(6-methoxy-3-pyridinyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 71581582 |
| Molecular Formula | C30H27F6N3O4 |
| Molecular Weight | 607.55 g/mol |
| Exact Mass | 607.19 |
| IUPAC Name | (2S)-N-(6-methoxy-3-pyridinyl)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(c3ccc(C)cc3)C[C@](c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)NC2=O)cn1 |
| InChI | InChI=1S/C30H27F6N3O4/c1-18-4-6-19(7-5-18)23-16-28(30(34,35)36,20-8-11-22(12-9-20)43-15-3-14-29(31,32)33)39-27(41)25(23)26(40)38-21-10-13-24(42-2)37-17-21/h4-13,17H,3,14-16H2,1-2H3,(H,38,40)(H,39,41)/t28-/m0/s1 |
| InChIKey | MVMXTEFREPVTMM-NDEPHWFRSA-N |
| XLogP | 6.49 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.55 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|