C27H26F6N2O3 — CID 71581583
(2S)-N-cyclopropyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 71581583) has the molecular formula C27H26F6N2O3 and a molecular weight of 540.50 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-N-cyclopropyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 71581583 |
| Molecular Formula | C27H26F6N2O3 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | (2S)-N-cyclopropyl-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)NC3CC3)C(=O)N[C@@](c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C27H26F6N2O3/c1-16-3-5-17(6-4-16)21-15-25(27(31,32)33,35-24(37)22(21)23(36)34-19-9-10-19)18-7-11-20(12-8-18)38-14-2-13-26(28,29)30/h3-8,11-12,19H,2,9-10,13-15H2,1H3,(H,34,36)(H,35,37)/t25-/m0/s1 |
| InChIKey | AGVPRSKJBAHSEV-VWLOTQADSA-N |
| XLogP | 5.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|