C31H25F9N2O4 — CID 71581778
(2S)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 71581778) has the molecular formula C31H25F9N2O4 and a molecular weight of 660.53 g/mol. Its IUPAC name is (2S)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 71581778 |
| Molecular Formula | C31H25F9N2O4 |
| Molecular Weight | 660.53 g/mol |
| Exact Mass | 660.17 |
| IUPAC Name | (2S)-4-(4-methylphenyl)-6-oxo-2-[4-(4,4,4-trifluorobutoxy)phenyl]-N-[4-(trifluoromethoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | Cc1ccc(C2=C(C(=O)Nc3ccc(OC(F)(F)F)cc3)C(=O)N[C@@](c3ccc(OCCCC(F)(F)F)cc3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C31H25F9N2O4/c1-18-3-5-19(6-4-18)24-17-28(30(35,36)37,20-7-11-22(12-8-20)45-16-2-15-29(32,33)34)42-27(44)25(24)26(43)41-21-9-13-23(14-10-21)46-31(38,39)40/h3-14H,2,15-17H2,1H3,(H,41,43)(H,42,44)/t28-/m0/s1 |
| InChIKey | GKAVUAJEZWYTNG-NDEPHWFRSA-N |
| XLogP | 7.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.53 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|