C26H28ClF3N4O3 — CID 71581931
2-[[1-(4-chlorobenzoyl)piperidin-4-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide (PubChem CID 71581931) has the molecular formula C26H28ClF3N4O3 and a molecular weight of 536.98 g/mol. Its IUPAC name is 2-[[1-(4-chlorobenzoyl)piperidin-4-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide.
| Compound Name | 2-[[1-(4-chlorobenzoyl)piperidin-4-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 71581931 |
| Molecular Formula | C26H28ClF3N4O3 |
| Molecular Weight | 536.98 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 2-[[1-(4-chlorobenzoyl)piperidin-4-yl]methyl]-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]indazole-5-carboxamide |
| SMILES | Cc1c(C(=O)NCCOCC(F)(F)F)ccc2nn(CC3CCN(C(=O)c4ccc(Cl)cc4)CC3)cc12 |
| InChI | InChI=1S/C26H28ClF3N4O3/c1-17-21(24(35)31-10-13-37-16-26(28,29)30)6-7-23-22(17)15-34(32-23)14-18-8-11-33(12-9-18)25(36)19-2-4-20(27)5-3-19/h2-7,15,18H,8-14,16H2,1H3,(H,31,35) |
| InChIKey | RUZRUHHOVKILDQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.98 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|