C17H21ClO — CID 71582008
1-(3-chlorophenyl)-2-(2,6,6-trimethylcyclohexen-1-yl)ethanone (PubChem CID 71582008) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-(2,6,6-trimethylcyclohexen-1-yl)ethanone.
| Compound Name | 1-(3-chlorophenyl)-2-(2,6,6-trimethylcyclohexen-1-yl)ethanone |
|---|---|
| PubChem CID | 71582008 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-(3-chlorophenyl)-2-(2,6,6-trimethylcyclohexen-1-yl)ethanone |
| SMILES | CC1=C(CC(=O)c2cccc(Cl)c2)C(C)(C)CCC1 |
| InChI | InChI=1S/C17H21ClO/c1-12-6-5-9-17(2,3)15(12)11-16(19)13-7-4-8-14(18)10-13/h4,7-8,10H,5-6,9,11H2,1-3H3 |
| InChIKey | GHNHRJCUIBMTSH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|