C19H27F2N3O — CID 71582171
N-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ylmethyl)-N-cyclopropyl-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 71582171) has the molecular formula C19H27F2N3O and a molecular weight of 351.44 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ylmethyl)-N-cyclopropyl-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ylmethyl)-N-cyclopropyl-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 71582171 |
| Molecular Formula | C19H27F2N3O |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-4-ylmethyl)-N-cyclopropyl-3-(difluoromethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N(CC2CCCC3CCCC32)C2CC2)c(C(F)F)n1 |
| InChI | InChI=1S/C19H27F2N3O/c1-23-11-16(17(22-23)18(20)21)19(25)24(14-8-9-14)10-13-6-2-4-12-5-3-7-15(12)13/h11-15,18H,2-10H2,1H3 |
| InChIKey | FAQZROLACQXQSH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |