About [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid
[phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid (PubChem CID 71583204) has the molecular formula C7H9N3O6P2S
and a molecular weight of 325.18 g/mol. Its IUPAC name is [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid.
Molecular Properties
| Compound Name | [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid |
| PubChem CID | 71583204 |
| Molecular Formula | C7H9N3O6P2S |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid |
| SMILES | O=P(O)(O)C(Nc1ncnc2sccc12)P(=O)(O)O |
| InChI | InChI=1S/C7H9N3O6P2S/c11-17(12,13)7(18(14,15)16)10-5-4-1-2-19-6(4)9-3-8-5/h1-3,7H,(H,8,9,10)(H2,11,12,13)(H2,14,15,16) |
| InChIKey | UAUWBUMIATVJNP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid?
The IUPAC name of [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid (CID 71583204) is [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid.
What is the SMILES notation for [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid?
The canonical SMILES for [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid is O=P(O)(O)C(Nc1ncnc2sccc12)P(=O)(O)O.
What is the InChIKey of [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid?
The InChIKey is UAUWBUMIATVJNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O6P2S/c11-17(12,13)7(18(14,15)16)10-5-4-1-2-19-6(4)9-3-8-5/h1-3,7H,(H,8,9,10)(H2,11,12,13)(H2,14,15,16).
What are the key properties of [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid?
[phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid has a molecular weight of 325.18 g/mol, XLogP of 0.74, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [phosphono-(thieno[2,3-d]pyrimidin-4-ylamino)methyl]phosphonic acid is sourced from PubChem (CID 71583204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).