C14H15N3O6P2S — CID 71583208
[[[6-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-phosphonomethyl]phosphonic acid (PubChem CID 71583208) has the molecular formula C14H15N3O6P2S and a molecular weight of 415.30 g/mol. Its IUPAC name is [[[6-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[[6-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 71583208 |
| Molecular Formula | C14H15N3O6P2S |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | [[[6-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]amino]-phosphonomethyl]phosphonic acid |
| SMILES | Cc1ccc(-c2cc3c(NC(P(=O)(O)O)P(=O)(O)O)ncnc3s2)cc1 |
| InChI | InChI=1S/C14H15N3O6P2S/c1-8-2-4-9(5-3-8)11-6-10-12(15-7-16-13(10)26-11)17-14(24(18,19)20)25(21,22)23/h2-7,14H,1H3,(H,15,16,17)(H2,18,19,20)(H2,21,22,23) |
| InChIKey | SFWLGYOMOJOLFV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 152.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|