C20H22N2 — CID 71583291
3-pentyl-1,5-diphenylpyrazole (PubChem CID 71583291) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-pentyl-1,5-diphenylpyrazole.
| Compound Name | 3-pentyl-1,5-diphenylpyrazole |
|---|---|
| PubChem CID | 71583291 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3-pentyl-1,5-diphenylpyrazole |
| SMILES | CCCCCc1cc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N2/c1-2-3-6-13-18-16-20(17-11-7-4-8-12-17)22(21-18)19-14-9-5-10-15-19/h4-5,7-12,14-16H,2-3,6,13H2,1H3 |
| InChIKey | KVAHLBXCWSNAJN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|