About 3-pentyl-1,5-diphenylpyrazole
3-pentyl-1,5-diphenylpyrazole (PubChem CID 71583291) has the molecular formula C20H22N2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-pentyl-1,5-diphenylpyrazole.
Molecular Properties
| Compound Name | 3-pentyl-1,5-diphenylpyrazole |
| PubChem CID | 71583291 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3-pentyl-1,5-diphenylpyrazole |
| SMILES | CCCCCc1cc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N2/c1-2-3-6-13-18-16-20(17-11-7-4-8-12-17)22(21-18)19-14-9-5-10-15-19/h4-5,7-12,14-16H,2-3,6,13H2,1H3 |
| InChIKey | KVAHLBXCWSNAJN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentyl-1,5-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentyl-1,5-diphenylpyrazole?
The IUPAC name of 3-pentyl-1,5-diphenylpyrazole (CID 71583291) is 3-pentyl-1,5-diphenylpyrazole.
What is the SMILES notation for 3-pentyl-1,5-diphenylpyrazole?
The canonical SMILES for 3-pentyl-1,5-diphenylpyrazole is CCCCCc1cc(-c2ccccc2)n(-c2ccccc2)n1.
What is the InChIKey of 3-pentyl-1,5-diphenylpyrazole?
The InChIKey is KVAHLBXCWSNAJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2/c1-2-3-6-13-18-16-20(17-11-7-4-8-12-17)22(21-18)19-14-9-5-10-15-19/h4-5,7-12,14-16H,2-3,6,13H2,1H3.
What are the key properties of 3-pentyl-1,5-diphenylpyrazole?
3-pentyl-1,5-diphenylpyrazole has a molecular weight of 290.41 g/mol, XLogP of 5.27, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentyl-1,5-diphenylpyrazole is sourced from PubChem (CID 71583291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).