C19H24N2O2 — CID 71583310
N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-2-phenylacetamide (PubChem CID 71583310) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-2-phenylacetamide.
| Compound Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 71583310 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-2-phenylacetamide |
| SMILES | CCCCn1c(C)c(C)cc(NC(=O)Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H24N2O2/c1-4-5-11-21-15(3)14(2)12-17(19(21)23)20-18(22)13-16-9-7-6-8-10-16/h6-10,12H,4-5,11,13H2,1-3H3,(H,20,22) |
| InChIKey | WZHWSKRVTIKEBV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |