About N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide
N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide (PubChem CID 71583311) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide.
Molecular Properties
| Compound Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide |
| PubChem CID | 71583311 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide |
| SMILES | CCCCn1c(C)c(C)cc(NC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C18H22N2O2/c1-4-5-11-20-14(3)13(2)12-16(18(20)22)19-17(21)15-9-7-6-8-10-15/h6-10,12H,4-5,11H2,1-3H3,(H,19,21) |
| InChIKey | HCQDNHCJTNBENO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide?
The IUPAC name of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide (CID 71583311) is N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide.
What is the SMILES notation for N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide?
The canonical SMILES for N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide is CCCCn1c(C)c(C)cc(NC(=O)c2ccccc2)c1=O.
What is the InChIKey of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide?
The InChIKey is HCQDNHCJTNBENO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-4-5-11-20-14(3)13(2)12-16(18(20)22)19-17(21)15-9-7-6-8-10-15/h6-10,12H,4-5,11H2,1-3H3,(H,19,21).
What are the key properties of N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide?
N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide has a molecular weight of 298.39 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)benzamide is sourced from PubChem (CID 71583311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).