About 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole (PubChem CID 71583401) has the molecular formula C20H19Cl3N2
and a molecular weight of 393.75 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole |
| PubChem CID | 71583401 |
| Molecular Formula | C20H19Cl3N2 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole |
| SMILES | CCCCCc1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C20H19Cl3N2/c1-2-3-4-5-17-13-20(14-6-8-15(21)9-7-14)25(24-17)19-11-10-16(22)12-18(19)23/h6-13H,2-5H2,1H3 |
| InChIKey | ZYWWZDGUSITUPO-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole?
The IUPAC name of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole (CID 71583401) is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole.
What is the SMILES notation for 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole?
The canonical SMILES for 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole is CCCCCc1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole?
The InChIKey is ZYWWZDGUSITUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl3N2/c1-2-3-4-5-17-13-20(14-6-8-15(21)9-7-14)25(24-17)19-11-10-16(22)12-18(19)23/h6-13H,2-5H2,1H3.
What are the key properties of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole?
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole has a molecular weight of 393.75 g/mol, XLogP of 7.23, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-pentylpyrazole is sourced from PubChem (CID 71583401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).