C21H21Cl3N2 — CID 71583402
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexylpyrazole (PubChem CID 71583402) has the molecular formula C21H21Cl3N2 and a molecular weight of 407.77 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexylpyrazole.
| Compound Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexylpyrazole |
|---|---|
| PubChem CID | 71583402 |
| Molecular Formula | C21H21Cl3N2 |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-hexylpyrazole |
| SMILES | CCCCCCc1cc(-c2ccc(Cl)cc2)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C21H21Cl3N2/c1-2-3-4-5-6-18-14-21(15-7-9-16(22)10-8-15)26(25-18)20-12-11-17(23)13-19(20)24/h7-14H,2-6H2,1H3 |
| InChIKey | AFGZZNBQSVRQPB-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|