C23H24Cl2N2O2S — CID 71584156
4-chloro-N-(4-chlorophenyl)-N-[[4-(diethylamino)phenyl]methyl]benzenesulfonamide (PubChem CID 71584156) has the molecular formula C23H24Cl2N2O2S and a molecular weight of 463.43 g/mol. Its IUPAC name is 4-chloro-N-(4-chlorophenyl)-N-[[4-(diethylamino)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(4-chlorophenyl)-N-[[4-(diethylamino)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71584156 |
| Molecular Formula | C23H24Cl2N2O2S |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 4-chloro-N-(4-chlorophenyl)-N-[[4-(diethylamino)phenyl]methyl]benzenesulfonamide |
| SMILES | CCN(CC)c1ccc(CN(c2ccc(Cl)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H24Cl2N2O2S/c1-3-26(4-2)21-11-5-18(6-12-21)17-27(22-13-7-19(24)8-14-22)30(28,29)23-15-9-20(25)10-16-23/h5-16H,3-4,17H2,1-2H3 |
| InChIKey | UCDUZZSIFKDOFO-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|