C12H7F4NO3S — CID 71584327
2,3,5,6-tetrafluoro-4-phenoxybenzenesulfonamide (PubChem CID 71584327) has the molecular formula C12H7F4NO3S and a molecular weight of 321.25 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-phenoxybenzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 71584327 |
| Molecular Formula | C12H7F4NO3S |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-phenoxybenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(Oc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C12H7F4NO3S/c13-7-9(15)12(21(17,18)19)10(16)8(14)11(7)20-6-4-2-1-3-5-6/h1-5H,(H2,17,18,19) |
| InChIKey | ODAPZIQZQHNWJS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|