C13H10F4N2O2S — CID 71584329
4-(benzylamino)-2,3,5,6-tetrafluorobenzenesulfonamide (PubChem CID 71584329) has the molecular formula C13H10F4N2O2S and a molecular weight of 334.29 g/mol. Its IUPAC name is 4-(benzylamino)-2,3,5,6-tetrafluorobenzenesulfonamide.
| Compound Name | 4-(benzylamino)-2,3,5,6-tetrafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 71584329 |
| Molecular Formula | C13H10F4N2O2S |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-(benzylamino)-2,3,5,6-tetrafluorobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(NCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C13H10F4N2O2S/c14-8-10(16)13(22(18,20)21)11(17)9(15)12(8)19-6-7-4-2-1-3-5-7/h1-5,19H,6H2,(H2,18,20,21) |
| InChIKey | OLILEWSPHMMGID-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|