C14H11F4NO2S2 — CID 71584331
2,3,5,6-tetrafluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide (PubChem CID 71584331) has the molecular formula C14H11F4NO2S2 and a molecular weight of 365.37 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71584331 |
| Molecular Formula | C14H11F4NO2S2 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2-phenylethylsulfanyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(F)c(F)c(SCCc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C14H11F4NO2S2/c15-9-11(17)14(23(19,20)21)12(18)10(16)13(9)22-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,19,20,21) |
| InChIKey | QVTWNMKKLBUIIT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|