C35H22F6N2O2S — CID 71584498
9-pyridin-2-ylsulfonyl-1,8-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]carbazole (PubChem CID 71584498) has the molecular formula C35H22F6N2O2S and a molecular weight of 648.63 g/mol. Its IUPAC name is 9-pyridin-2-ylsulfonyl-1,8-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]carbazole.
| Compound Name | 9-pyridin-2-ylsulfonyl-1,8-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]carbazole |
|---|---|
| PubChem CID | 71584498 |
| Molecular Formula | C35H22F6N2O2S |
| Molecular Weight | 648.63 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | 9-pyridin-2-ylsulfonyl-1,8-bis[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]carbazole |
| SMILES | O=S(=O)(c1ccccn1)n1c2c(/C=C/c3ccc(C(F)(F)F)cc3)cccc2c2cccc(/C=C/c3ccc(C(F)(F)F)cc3)c21 |
| InChI | InChI=1S/C35H22F6N2O2S/c36-34(37,38)27-18-12-23(13-19-27)10-16-25-5-3-7-29-30-8-4-6-26(17-11-24-14-20-28(21-15-24)35(39,40)41)33(30)43(32(25)29)46(44,45)31-9-1-2-22-42-31/h1-22H/b16-10+,17-11+ |
| InChIKey | OVIBEXSWYOKKLK-OTYYAQKOSA-N |
| XLogP | 9.80 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.63 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|