C23H27N3O2 — CID 71584654
2-amino-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboxylic acid (PubChem CID 71584654) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-amino-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboxylic acid.
| Compound Name | 2-amino-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 71584654 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-amino-1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)benzimidazole-5-carboxylic acid |
| SMILES | Cc1cc2c(cc1-n1c(N)nc3cc(C(=O)O)ccc31)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C23H27N3O2/c1-13-10-15-16(23(4,5)9-8-22(15,2)3)12-19(13)26-18-7-6-14(20(27)28)11-17(18)25-21(26)24/h6-7,10-12H,8-9H2,1-5H3,(H2,24,25)(H,27,28) |
| InChIKey | WWFKXOHNVWKPRM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |