C31H42F3NO5S — CID 71585000
5-[6-[2-hydroxyethyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-6-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 71585000) has the molecular formula C31H42F3NO5S and a molecular weight of 597.74 g/mol. Its IUPAC name is 5-[6-[2-hydroxyethyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-6-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 5-[6-[2-hydroxyethyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-6-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 71585000 |
| Molecular Formula | C31H42F3NO5S |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | 5-[6-[2-hydroxyethyl-[3-(3,3,3-trifluoropropylsulfonyl)propyl]amino]hexyl]-6-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | O=S(=O)(CCCN(CCO)CCCCCCC1=C(c2cccc(O)c2)CCCc2cc(O)ccc21)CCC(F)(F)F |
| InChI | InChI=1S/C31H42F3NO5S/c32-31(33,34)15-21-41(39,40)20-7-17-35(18-19-36)16-4-2-1-3-11-30-28(24-8-5-10-26(37)22-24)12-6-9-25-23-27(38)13-14-29(25)30/h5,8,10,13-14,22-23,36-38H,1-4,6-7,9,11-12,15-21H2 |
| InChIKey | IXXJJVMKOADNFB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|