C33H36ClN7O3 — CID 71585182
1-[3-tert-butyl-1-(3-chloro-4-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea (PubChem CID 71585182) has the molecular formula C33H36ClN7O3 and a molecular weight of 614.15 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(3-chloro-4-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-1-(3-chloro-4-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
|---|---|
| PubChem CID | 71585182 |
| Molecular Formula | C33H36ClN7O3 |
| Molecular Weight | 614.15 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 1-[3-tert-butyl-1-(3-chloro-4-hydroxyphenyl)pyrazol-5-yl]-3-[(1S,4R)-4-[(3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)oxy]-1,2,3,4-tetrahydronaphthalen-1-yl]urea |
| SMILES | CC(C)c1nnc2ccc(O[C@@H]3CC[C@H](NC(=O)Nc4cc(C(C)(C)C)nn4-c4ccc(O)c(Cl)c4)c4ccccc43)cn12 |
| InChI | InChI=1S/C33H36ClN7O3/c1-19(2)31-38-37-29-15-11-21(18-40(29)31)44-27-14-12-25(22-8-6-7-9-23(22)27)35-32(43)36-30-17-28(33(3,4)5)39-41(30)20-10-13-26(42)24(34)16-20/h6-11,13,15-19,25,27,42H,12,14H2,1-5H3,(H2,35,36,43)/t25-,27+/m0/s1 |
| InChIKey | RICCKZLKSHZYDD-AHKZPQOWSA-N |
| XLogP | 7.47 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.15 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |