C18H14F4N2O5S2 — CID 71585334
3-oxo-1-propan-2-yl-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)-2,1-benzothiazole-5-sulfonamide (PubChem CID 71585334) has the molecular formula C18H14F4N2O5S2 and a molecular weight of 478.45 g/mol. Its IUPAC name is 3-oxo-1-propan-2-yl-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)-2,1-benzothiazole-5-sulfonamide.
| Compound Name | 3-oxo-1-propan-2-yl-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)-2,1-benzothiazole-5-sulfonamide |
|---|---|
| PubChem CID | 71585334 |
| Molecular Formula | C18H14F4N2O5S2 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | 3-oxo-1-propan-2-yl-N-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)-2,1-benzothiazole-5-sulfonamide |
| SMILES | CC(C)n1sc(=O)c2cc(S(=O)(=O)Nc3cccc4c3OC(F)(F)C(F)(F)O4)ccc21 |
| InChI | InChI=1S/C18H14F4N2O5S2/c1-9(2)24-13-7-6-10(8-11(13)16(25)30-24)31(26,27)23-12-4-3-5-14-15(12)29-18(21,22)17(19,20)28-14/h3-9,23H,1-2H3 |
| InChIKey | ZECBSRSKEVBJLP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|