C21H15F3N4O3S — CID 71585430
N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)phenyl]isoquinoline-6-sulfonamide (PubChem CID 71585430) has the molecular formula C21H15F3N4O3S and a molecular weight of 460.44 g/mol. Its IUPAC name is N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)phenyl]isoquinoline-6-sulfonamide.
| Compound Name | N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)phenyl]isoquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 71585430 |
| Molecular Formula | C21H15F3N4O3S |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)phenyl]isoquinoline-6-sulfonamide |
| SMILES | O=S(=O)(Nc1ccncn1)c1ccc2c(-c3ccccc3OCC(F)(F)F)nccc2c1 |
| InChI | InChI=1S/C21H15F3N4O3S/c22-21(23,24)12-31-18-4-2-1-3-17(18)20-16-6-5-15(11-14(16)7-10-26-20)32(29,30)28-19-8-9-25-13-27-19/h1-11,13H,12H2,(H,25,27,28) |
| InChIKey | UWYUWMYBCYFDJR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |