C29H31NO6 — CID 7158552
(3R)-3-[4-(diethoxymethyl)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 7158552) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is (3R)-3-[4-(diethoxymethyl)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | (3R)-3-[4-(diethoxymethyl)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 7158552 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (3R)-3-[4-(diethoxymethyl)phenyl]-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | CCOC(OCC)c1ccc([C@@H](CC(=O)O)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C29H31NO6/c1-3-34-28(35-4-2)20-15-13-19(14-16-20)26(17-27(31)32)30-29(33)36-18-25-23-11-7-5-9-21(23)22-10-6-8-12-24(22)25/h5-16,25-26,28H,3-4,17-18H2,1-2H3,(H,30,33)(H,31,32)/t26-/m1/s1 |
| InChIKey | OGMOSIOVGSBUIJ-AREMUKBSSA-N |
| XLogP | 5.81 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|