C18H19N3O5 — CID 71585551
5-(3,4-dimethoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione (PubChem CID 71585551) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71585551 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-5-[(3-methyl-2-oxo-1-pyridinyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(Cn3cccc(C)c3=O)NC(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C18H19N3O5/c1-11-5-4-8-21(15(11)22)10-18(16(23)19-17(24)20-18)12-6-7-13(25-2)14(9-12)26-3/h4-9H,10H2,1-3H3,(H2,19,20,23,24) |
| InChIKey | OQESGEFNLAJHLP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|