C31H47FN8O5 — CID 71585691
N-[(8S,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-18-(4-fluorophenyl)-11-methyl-7,10,17,20-tetraoxo-6,9,16,19-tetrazaspiro[4.15]icosan-11-yl]-2-methylpropanamide (PubChem CID 71585691) has the molecular formula C31H47FN8O5 and a molecular weight of 630.77 g/mol. Its IUPAC name is N-[(8S,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-18-(4-fluorophenyl)-11-methyl-7,10,17,20-tetraoxo-6,9,16,19-tetrazaspiro[4.15]icosan-11-yl]-2-methylpropanamide.
| Compound Name | N-[(8S,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-18-(4-fluorophenyl)-11-methyl-7,10,17,20-tetraoxo-6,9,16,19-tetrazaspiro[4.15]icosan-11-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 71585691 |
| Molecular Formula | C31H47FN8O5 |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | N-[(8S,11R,18R)-8-[3-(diaminomethylideneamino)propyl]-18-(4-fluorophenyl)-11-methyl-7,10,17,20-tetraoxo-6,9,16,19-tetrazaspiro[4.15]icosan-11-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@]1(C)CCCCNC(=O)[C@@H](c2ccc(F)cc2)NC(=O)C2(CCCC2)NC(=O)[C@H](CCCN=C(N)N)NC1=O |
| InChI | InChI=1S/C31H47FN8O5/c1-19(2)24(41)39-30(3)14-6-7-17-35-26(43)23(20-10-12-21(32)13-11-20)38-28(45)31(15-4-5-16-31)40-25(42)22(37-27(30)44)9-8-18-36-29(33)34/h10-13,19,22-23H,4-9,14-18H2,1-3H3,(H,35,43)(H,37,44)(H,38,45)(H,39,41)(H,40,42)(H4,33,34,36)/t22-,23+,30+/m0/s1 |
| InChIKey | MWXOQRCBXFKYFH-DDFCPOBKSA-N |
| XLogP | 0.78 |
| TPSA | 209.90 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|